C26H30N2O2 — CID 66546401
N,N-diethyl-9-(1-prop-2-enylpiperidin-4-ylidene)xanthene-3-carboxamide (PubChem CID 66546401) has the molecular formula C26H30N2O2 and a molecular weight of 402.54 g/mol. Its IUPAC name is N,N-diethyl-9-(1-prop-2-enylpiperidin-4-ylidene)xanthene-3-carboxamide.
| Compound Name | N,N-diethyl-9-(1-prop-2-enylpiperidin-4-ylidene)xanthene-3-carboxamide |
|---|---|
| PubChem CID | 66546401 |
| Molecular Formula | C26H30N2O2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | N,N-diethyl-9-(1-prop-2-enylpiperidin-4-ylidene)xanthene-3-carboxamide |
| SMILES | C=CCN1CCC(=C2c3ccccc3Oc3cc(C(=O)N(CC)CC)ccc32)CC1 |
| InChI | InChI=1S/C26H30N2O2/c1-4-15-27-16-13-19(14-17-27)25-21-9-7-8-10-23(21)30-24-18-20(11-12-22(24)25)26(29)28(5-2)6-3/h4,7-12,18H,1,5-6,13-17H2,2-3H3 |
| InChIKey | LBEYAFFVHDCMQY-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|