About 5-chloro-N-[[4-(2,4-difluorophenyl)phenyl]methyl]-1H-indole-2-sulfonamide
5-chloro-N-[[4-(2,4-difluorophenyl)phenyl]methyl]-1H-indole-2-sulfonamide (PubChem CID 66546526) has the molecular formula C21H15ClF2N2O2S
and a molecular weight of 432.88 g/mol. Its IUPAC name is 5-chloro-N-[[4-(2,4-difluorophenyl)phenyl]methyl]-1H-indole-2-sulfonamide.
Molecular Properties
| Compound Name | 5-chloro-N-[[4-(2,4-difluorophenyl)phenyl]methyl]-1H-indole-2-sulfonamide |
| PubChem CID | 66546526 |
| Molecular Formula | C21H15ClF2N2O2S |
| Molecular Weight | 432.88 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | 5-chloro-N-[[4-(2,4-difluorophenyl)phenyl]methyl]-1H-indole-2-sulfonamide |
| SMILES | O=S(=O)(NCc1ccc(-c2ccc(F)cc2F)cc1)c1cc2cc(Cl)ccc2[nH]1 |
| InChI | InChI=1S/C21H15ClF2N2O2S/c22-16-5-8-20-15(9-16)10-21(26-20)29(27,28)25-12-13-1-3-14(4-2-13)18-7-6-17(23)11-19(18)24/h1-11,25-26H,12H2 |
| InChIKey | HDOZXLRUUDIYEY-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.88 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-chloro-N-[[4-(2,4-difluorophenyl)phenyl]methyl]-1H-indole-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-[[4-(2,4-difluorophenyl)phenyl]methyl]-1H-indole-2-sulfonamide?
The IUPAC name of 5-chloro-N-[[4-(2,4-difluorophenyl)phenyl]methyl]-1H-indole-2-sulfonamide (CID 66546526) is 5-chloro-N-[[4-(2,4-difluorophenyl)phenyl]methyl]-1H-indole-2-sulfonamide.
What is the SMILES notation for 5-chloro-N-[[4-(2,4-difluorophenyl)phenyl]methyl]-1H-indole-2-sulfonamide?
The canonical SMILES for 5-chloro-N-[[4-(2,4-difluorophenyl)phenyl]methyl]-1H-indole-2-sulfonamide is O=S(=O)(NCc1ccc(-c2ccc(F)cc2F)cc1)c1cc2cc(Cl)ccc2[nH]1.
What is the InChIKey of 5-chloro-N-[[4-(2,4-difluorophenyl)phenyl]methyl]-1H-indole-2-sulfonamide?
The InChIKey is HDOZXLRUUDIYEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15ClF2N2O2S/c22-16-5-8-20-15(9-16)10-21(26-20)29(27,28)25-12-13-1-3-14(4-2-13)18-7-6-17(23)11-19(18)24/h1-11,25-26H,12H2.
What are the key properties of 5-chloro-N-[[4-(2,4-difluorophenyl)phenyl]methyl]-1H-indole-2-sulfonamide?
5-chloro-N-[[4-(2,4-difluorophenyl)phenyl]methyl]-1H-indole-2-sulfonamide has a molecular weight of 432.88 g/mol, XLogP of 5.24, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-[[4-(2,4-difluorophenyl)phenyl]methyl]-1H-indole-2-sulfonamide is sourced from PubChem (CID 66546526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).