C19H20Cl2N4O3 — CID 66546864
N-(2,6-dichloro-3-pyridinyl)-3-[4-(3-methoxyphenyl)piperazin-1-yl]-3-oxopropanamide (PubChem CID 66546864) has the molecular formula C19H20Cl2N4O3 and a molecular weight of 423.30 g/mol. Its IUPAC name is N-(2,6-dichloro-3-pyridinyl)-3-[4-(3-methoxyphenyl)piperazin-1-yl]-3-oxopropanamide.
| Compound Name | N-(2,6-dichloro-3-pyridinyl)-3-[4-(3-methoxyphenyl)piperazin-1-yl]-3-oxopropanamide |
|---|---|
| PubChem CID | 66546864 |
| Molecular Formula | C19H20Cl2N4O3 |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | N-(2,6-dichloro-3-pyridinyl)-3-[4-(3-methoxyphenyl)piperazin-1-yl]-3-oxopropanamide |
| SMILES | COc1cccc(N2CCN(C(=O)CC(=O)Nc3ccc(Cl)nc3Cl)CC2)c1 |
| InChI | InChI=1S/C19H20Cl2N4O3/c1-28-14-4-2-3-13(11-14)24-7-9-25(10-8-24)18(27)12-17(26)22-15-5-6-16(20)23-19(15)21/h2-6,11H,7-10,12H2,1H3,(H,22,26) |
| InChIKey | NWMDMWXZTSZJIB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|