C22H24ClF3N4O — CID 66547488
(5R)-5-[5-[(3-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)amino]-2-fluorophenyl]-6,6-difluoro-5,7,7-trimethyl-2H-1,4-oxazepin-3-amine (PubChem CID 66547488) has the molecular formula C22H24ClF3N4O and a molecular weight of 452.91 g/mol. Its IUPAC name is (5R)-5-[5-[(3-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)amino]-2-fluorophenyl]-6,6-difluoro-5,7,7-trimethyl-2H-1,4-oxazepin-3-amine.
| Compound Name | (5R)-5-[5-[(3-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)amino]-2-fluorophenyl]-6,6-difluoro-5,7,7-trimethyl-2H-1,4-oxazepin-3-amine |
|---|---|
| PubChem CID | 66547488 |
| Molecular Formula | C22H24ClF3N4O |
| Molecular Weight | 452.91 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | (5R)-5-[5-[(3-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)amino]-2-fluorophenyl]-6,6-difluoro-5,7,7-trimethyl-2H-1,4-oxazepin-3-amine |
| SMILES | CC1(C)OCC(N)=N[C@](C)(c2cc(NC3CCc4cc(Cl)cnc43)ccc2F)C1(F)F |
| InChI | InChI=1S/C22H24ClF3N4O/c1-20(2)22(25,26)21(3,30-18(27)11-31-20)15-9-14(5-6-16(15)24)29-17-7-4-12-8-13(23)10-28-19(12)17/h5-6,8-10,17,29H,4,7,11H2,1-3H3,(H2,27,30)/t17?,21-/m1/s1 |
| InChIKey | QEQRMWYXLWHPTH-FBLFFUNLSA-N |
| XLogP | 4.99 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.91 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |