C19H20ClF3N4O — CID 66547660
(5R)-5-[5-[(6-chloro-3-pyridinyl)amino]-2-fluorophenyl]-6,6-difluoro-5,7,7-trimethyl-2H-1,4-oxazepin-3-amine (PubChem CID 66547660) has the molecular formula C19H20ClF3N4O and a molecular weight of 412.84 g/mol. Its IUPAC name is (5R)-5-[5-[(6-chloro-3-pyridinyl)amino]-2-fluorophenyl]-6,6-difluoro-5,7,7-trimethyl-2H-1,4-oxazepin-3-amine.
| Compound Name | (5R)-5-[5-[(6-chloro-3-pyridinyl)amino]-2-fluorophenyl]-6,6-difluoro-5,7,7-trimethyl-2H-1,4-oxazepin-3-amine |
|---|---|
| PubChem CID | 66547660 |
| Molecular Formula | C19H20ClF3N4O |
| Molecular Weight | 412.84 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | (5R)-5-[5-[(6-chloro-3-pyridinyl)amino]-2-fluorophenyl]-6,6-difluoro-5,7,7-trimethyl-2H-1,4-oxazepin-3-amine |
| SMILES | CC1(C)OCC(N)=N[C@](C)(c2cc(Nc3ccc(Cl)nc3)ccc2F)C1(F)F |
| InChI | InChI=1S/C19H20ClF3N4O/c1-17(2)19(22,23)18(3,27-16(24)10-28-17)13-8-11(4-6-14(13)21)26-12-5-7-15(20)25-9-12/h4-9,26H,10H2,1-3H3,(H2,24,27)/t18-/m1/s1 |
| InChIKey | ZHRCZUUYWIYZLZ-GOSISDBHSA-N |
| XLogP | 4.63 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.84 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|