About (2S)-2-amino-3,3-dimethyl-1-thiomorpholin-4-ylbutan-1-one;hydrochloride
(2S)-2-amino-3,3-dimethyl-1-thiomorpholin-4-ylbutan-1-one;hydrochloride (PubChem CID 66548466) has the molecular formula C10H21ClN2OS
and a molecular weight of 252.81 g/mol. Its IUPAC name is (2S)-2-amino-3,3-dimethyl-1-thiomorpholin-4-ylbutan-1-one;hydrochloride.
Molecular Properties
| Compound Name | (2S)-2-amino-3,3-dimethyl-1-thiomorpholin-4-ylbutan-1-one;hydrochloride |
| PubChem CID | 66548466 |
| Molecular Formula | C10H21ClN2OS |
| Molecular Weight | 252.81 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | (2S)-2-amino-3,3-dimethyl-1-thiomorpholin-4-ylbutan-1-one;hydrochloride |
| SMILES | CC(C)(C)[C@H](N)C(=O)N1CCSCC1.Cl |
| InChI | InChI=1S/C10H20N2OS.ClH/c1-10(2,3)8(11)9(13)12-4-6-14-7-5-12;/h8H,4-7,11H2,1-3H3;1H/t8-;/m1./s1 |
| InChIKey | KGDNHIVYFWWOGK-DDWIOCJRSA-N |
| XLogP | 1.36 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.81 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-amino-3,3-dimethyl-1-thiomorpholin-4-ylbutan-1-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-3,3-dimethyl-1-thiomorpholin-4-ylbutan-1-one;hydrochloride?
The IUPAC name of (2S)-2-amino-3,3-dimethyl-1-thiomorpholin-4-ylbutan-1-one;hydrochloride (CID 66548466) is (2S)-2-amino-3,3-dimethyl-1-thiomorpholin-4-ylbutan-1-one;hydrochloride.
What is the SMILES notation for (2S)-2-amino-3,3-dimethyl-1-thiomorpholin-4-ylbutan-1-one;hydrochloride?
The canonical SMILES for (2S)-2-amino-3,3-dimethyl-1-thiomorpholin-4-ylbutan-1-one;hydrochloride is CC(C)(C)[C@H](N)C(=O)N1CCSCC1.Cl.
What is the InChIKey of (2S)-2-amino-3,3-dimethyl-1-thiomorpholin-4-ylbutan-1-one;hydrochloride?
The InChIKey is KGDNHIVYFWWOGK-DDWIOCJRSA-N. The full InChI is InChI=1S/C10H20N2OS.ClH/c1-10(2,3)8(11)9(13)12-4-6-14-7-5-12;/h8H,4-7,11H2,1-3H3;1H/t8-;/m1./s1.
What are the key properties of (2S)-2-amino-3,3-dimethyl-1-thiomorpholin-4-ylbutan-1-one;hydrochloride?
(2S)-2-amino-3,3-dimethyl-1-thiomorpholin-4-ylbutan-1-one;hydrochloride has a molecular weight of 252.81 g/mol, XLogP of 1.36, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-3,3-dimethyl-1-thiomorpholin-4-ylbutan-1-one;hydrochloride is sourced from PubChem (CID 66548466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).