C20H29N5O6 — CID 66549181
(2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-N-[(4-methylphenyl)methyl]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 66549181) has the molecular formula C20H29N5O6 and a molecular weight of 435.48 g/mol. Its IUPAC name is (2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-N-[(4-methylphenyl)methyl]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-N-[(4-methylphenyl)methyl]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 66549181 |
| Molecular Formula | C20H29N5O6 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | (2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-N-[(4-methylphenyl)methyl]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CC(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CO)OC(C(=O)NCc2ccc(C)cc2)=C[C@@H]1N=C(N)N |
| InChI | InChI=1S/C20H29N5O6/c1-10-3-5-12(6-4-10)8-23-19(30)15-7-13(25-20(21)22)16(24-11(2)27)18(31-15)17(29)14(28)9-26/h3-7,13-14,16-18,26,28-29H,8-9H2,1-2H3,(H,23,30)(H,24,27)(H4,21,22,25)/t13-,14+,16+,17+,18+/m0/s1 |
| InChIKey | ASXATILCGXATDK-QBBQCFRVSA-N |
| XLogP | -2.25 |
| TPSA | 192.52 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|