C21H17Cl3F3N3O2 — CID 66549232
N-methyl-1-[4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]azetidine-3-carboxamide (PubChem CID 66549232) has the molecular formula C21H17Cl3F3N3O2 and a molecular weight of 506.74 g/mol. Its IUPAC name is N-methyl-1-[4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]azetidine-3-carboxamide.
| Compound Name | N-methyl-1-[4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]azetidine-3-carboxamide |
|---|---|
| PubChem CID | 66549232 |
| Molecular Formula | C21H17Cl3F3N3O2 |
| Molecular Weight | 506.74 g/mol |
| Exact Mass | 505.03 |
| IUPAC Name | N-methyl-1-[4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]azetidine-3-carboxamide |
| SMILES | CNC(=O)C1CN(c2ccc(C3=NOC(c4cc(Cl)c(Cl)c(Cl)c4)(C(F)(F)F)C3)cc2)C1 |
| InChI | InChI=1S/C21H17Cl3F3N3O2/c1-28-19(31)12-9-30(10-12)14-4-2-11(3-5-14)17-8-20(32-29-17,21(25,26)27)13-6-15(22)18(24)16(23)7-13/h2-7,12H,8-10H2,1H3,(H,28,31) |
| InChIKey | LNRMSRDWXWCWSH-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.74 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|