C22H16Cl3F6N3O2 — CID 66549233
1-[4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-N-(2,2,2-trifluoroethyl)azetidine-3-carboxamide (PubChem CID 66549233) has the molecular formula C22H16Cl3F6N3O2 and a molecular weight of 574.74 g/mol. Its IUPAC name is 1-[4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-N-(2,2,2-trifluoroethyl)azetidine-3-carboxamide.
| Compound Name | 1-[4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-N-(2,2,2-trifluoroethyl)azetidine-3-carboxamide |
|---|---|
| PubChem CID | 66549233 |
| Molecular Formula | C22H16Cl3F6N3O2 |
| Molecular Weight | 574.74 g/mol |
| Exact Mass | 573.02 |
| IUPAC Name | 1-[4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-N-(2,2,2-trifluoroethyl)azetidine-3-carboxamide |
| SMILES | O=C(NCC(F)(F)F)C1CN(c2ccc(C3=NOC(c4cc(Cl)c(Cl)c(Cl)c4)(C(F)(F)F)C3)cc2)C1 |
| InChI | InChI=1S/C22H16Cl3F6N3O2/c23-15-5-13(6-16(24)18(15)25)20(22(29,30)31)7-17(33-36-20)11-1-3-14(4-2-11)34-8-12(9-34)19(35)32-10-21(26,27)28/h1-6,12H,7-10H2,(H,32,35) |
| InChIKey | QHHCKZIOVBCRGJ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.74 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|