About bis[4-(dimethylamino)-2,3-dimethylphenyl]methanone
bis[4-(dimethylamino)-2,3-dimethylphenyl]methanone (PubChem CID 66549240) has the molecular formula C21H28N2O
and a molecular weight of 324.47 g/mol. Its IUPAC name is bis[4-(dimethylamino)-2,3-dimethylphenyl]methanone.
Molecular Properties
| Compound Name | bis[4-(dimethylamino)-2,3-dimethylphenyl]methanone |
| PubChem CID | 66549240 |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | bis[4-(dimethylamino)-2,3-dimethylphenyl]methanone |
| SMILES | Cc1c(C(=O)c2ccc(N(C)C)c(C)c2C)ccc(N(C)C)c1C |
| InChI | InChI=1S/C21H28N2O/c1-13-15(3)19(22(5)6)11-9-17(13)21(24)18-10-12-20(23(7)8)16(4)14(18)2/h9-12H,1-8H3 |
| InChIKey | OQEXMOLROLJOJA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze bis[4-(dimethylamino)-2,3-dimethylphenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[4-(dimethylamino)-2,3-dimethylphenyl]methanone?
The IUPAC name of bis[4-(dimethylamino)-2,3-dimethylphenyl]methanone (CID 66549240) is bis[4-(dimethylamino)-2,3-dimethylphenyl]methanone.
What is the SMILES notation for bis[4-(dimethylamino)-2,3-dimethylphenyl]methanone?
The canonical SMILES for bis[4-(dimethylamino)-2,3-dimethylphenyl]methanone is Cc1c(C(=O)c2ccc(N(C)C)c(C)c2C)ccc(N(C)C)c1C.
What is the InChIKey of bis[4-(dimethylamino)-2,3-dimethylphenyl]methanone?
The InChIKey is OQEXMOLROLJOJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28N2O/c1-13-15(3)19(22(5)6)11-9-17(13)21(24)18-10-12-20(23(7)8)16(4)14(18)2/h9-12H,1-8H3.
What are the key properties of bis[4-(dimethylamino)-2,3-dimethylphenyl]methanone?
bis[4-(dimethylamino)-2,3-dimethylphenyl]methanone has a molecular weight of 324.47 g/mol, XLogP of 4.28, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis[4-(dimethylamino)-2,3-dimethylphenyl]methanone is sourced from PubChem (CID 66549240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).