C19H26FN5O6 — CID 66549366
(2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-N-[(4-fluorophenyl)methyl]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 66549366) has the molecular formula C19H26FN5O6 and a molecular weight of 439.44 g/mol. Its IUPAC name is (2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-N-[(4-fluorophenyl)methyl]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-N-[(4-fluorophenyl)methyl]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 66549366 |
| Molecular Formula | C19H26FN5O6 |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | (2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-N-[(4-fluorophenyl)methyl]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CC(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CO)OC(C(=O)NCc2ccc(F)cc2)=C[C@@H]1N=C(N)N |
| InChI | InChI=1S/C19H26FN5O6/c1-9(27)24-15-12(25-19(21)22)6-14(31-17(15)16(29)13(28)8-26)18(30)23-7-10-2-4-11(20)5-3-10/h2-6,12-13,15-17,26,28-29H,7-8H2,1H3,(H,23,30)(H,24,27)(H4,21,22,25)/t12-,13+,15+,16+,17+/m0/s1 |
| InChIKey | YTPXTTIIJKRFSC-IHWGESPNSA-N |
| XLogP | -2.41 |
| TPSA | 192.52 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|