C22H15Cl4F6N3O2 — CID 66549427
1-[2-chloro-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-N-(2,2,2-trifluoroethyl)azetidine-3-carboxamide (PubChem CID 66549427) has the molecular formula C22H15Cl4F6N3O2 and a molecular weight of 609.18 g/mol. Its IUPAC name is 1-[2-chloro-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-N-(2,2,2-trifluoroethyl)azetidine-3-carboxamide.
| Compound Name | 1-[2-chloro-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-N-(2,2,2-trifluoroethyl)azetidine-3-carboxamide |
|---|---|
| PubChem CID | 66549427 |
| Molecular Formula | C22H15Cl4F6N3O2 |
| Molecular Weight | 609.18 g/mol |
| Exact Mass | 606.98 |
| IUPAC Name | 1-[2-chloro-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-N-(2,2,2-trifluoroethyl)azetidine-3-carboxamide |
| SMILES | O=C(NCC(F)(F)F)C1CN(c2ccc(C3=NOC(c4cc(Cl)c(Cl)c(Cl)c4)(C(F)(F)F)C3)cc2Cl)C1 |
| InChI | InChI=1S/C22H15Cl4F6N3O2/c23-13-3-10(1-2-17(13)35-7-11(8-35)19(36)33-9-21(27,28)29)16-6-20(37-34-16,22(30,31)32)12-4-14(24)18(26)15(25)5-12/h1-5,11H,6-9H2,(H,33,36) |
| InChIKey | OLKVEOJNXAOWIK-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.18 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|