C31H41NO5 — CID 66549442
(2Z,10R,13S,17S)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(hydroxymethylidene)-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-17-carboxamide (PubChem CID 66549442) has the molecular formula C31H41NO5 and a molecular weight of 507.67 g/mol. Its IUPAC name is (2Z,10R,13S,17S)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(hydroxymethylidene)-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-17-carboxamide.
| Compound Name | (2Z,10R,13S,17S)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(hydroxymethylidene)-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-17-carboxamide |
|---|---|
| PubChem CID | 66549442 |
| Molecular Formula | C31H41NO5 |
| Molecular Weight | 507.67 g/mol |
| Exact Mass | 507.30 |
| IUPAC Name | (2Z,10R,13S,17S)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(hydroxymethylidene)-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-17-carboxamide |
| SMILES | COc1ccc(CCNC(=O)[C@H]2CCC3C4CCC5=CC(=O)/C(=C\O)C[C@]5(C)C4CC[C@@]32C)cc1OC |
| InChI | InChI=1S/C31H41NO5/c1-30-13-11-24-22(7-6-21-16-26(34)20(18-33)17-31(21,24)2)23(30)8-9-25(30)29(35)32-14-12-19-5-10-27(36-3)28(15-19)37-4/h5,10,15-16,18,22-25,33H,6-9,11-14,17H2,1-4H3,(H,32,35)/b20-18-/t22?,23?,24?,25-,30+,31+/m1/s1 |
| InChIKey | NZARDEZMUQULCR-HOVXJBRWSA-N |
| XLogP | 5.56 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.67 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|