C23H18ClN5O2 — CID 66549600
N-[3-[(4-chlorophenyl)methoxy]phenyl]-2-(pyridin-4-ylamino)pyrimidine-4-carboxamide (PubChem CID 66549600) has the molecular formula C23H18ClN5O2 and a molecular weight of 431.88 g/mol. Its IUPAC name is N-[3-[(4-chlorophenyl)methoxy]phenyl]-2-(pyridin-4-ylamino)pyrimidine-4-carboxamide.
| Compound Name | N-[3-[(4-chlorophenyl)methoxy]phenyl]-2-(pyridin-4-ylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 66549600 |
| Molecular Formula | C23H18ClN5O2 |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | N-[3-[(4-chlorophenyl)methoxy]phenyl]-2-(pyridin-4-ylamino)pyrimidine-4-carboxamide |
| SMILES | O=C(Nc1cccc(OCc2ccc(Cl)cc2)c1)c1ccnc(Nc2ccncc2)n1 |
| InChI | InChI=1S/C23H18ClN5O2/c24-17-6-4-16(5-7-17)15-31-20-3-1-2-19(14-20)27-22(30)21-10-13-26-23(29-21)28-18-8-11-25-12-9-18/h1-14H,15H2,(H,27,30)(H,25,26,28,29) |
| InChIKey | NRQMVTBQEIXTQK-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |