C23H22Cl2N2O2 — CID 66549880
5-[(2,4-dichlorophenyl)methyl]-6-(4-phenylcyclohexyl)-1H-pyrimidine-2,4-dione (PubChem CID 66549880) has the molecular formula C23H22Cl2N2O2 and a molecular weight of 429.35 g/mol. Its IUPAC name is 5-[(2,4-dichlorophenyl)methyl]-6-(4-phenylcyclohexyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[(2,4-dichlorophenyl)methyl]-6-(4-phenylcyclohexyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 66549880 |
| Molecular Formula | C23H22Cl2N2O2 |
| Molecular Weight | 429.35 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 5-[(2,4-dichlorophenyl)methyl]-6-(4-phenylcyclohexyl)-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(C2CCC(c3ccccc3)CC2)c(Cc2ccc(Cl)cc2Cl)c(=O)[nH]1 |
| InChI | InChI=1S/C23H22Cl2N2O2/c24-18-11-10-17(20(25)13-18)12-19-21(26-23(29)27-22(19)28)16-8-6-15(7-9-16)14-4-2-1-3-5-14/h1-5,10-11,13,15-16H,6-9,12H2,(H2,26,27,28,29) |
| InChIKey | XKNKJFGPZIVCTA-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.35 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |