C20H26O3 — CID 66550155
(4aS,9aS)-4a-benzylspiro[1,3,4,6,7,8,9,9a-octahydrobenzo[7]annulene-2,2'-1,3-dioxolane]-5-one (PubChem CID 66550155) has the molecular formula C20H26O3 and a molecular weight of 314.42 g/mol. Its IUPAC name is (4aS,9aS)-4a-benzylspiro[1,3,4,6,7,8,9,9a-octahydrobenzo[7]annulene-2,2'-1,3-dioxolane]-5-one.
| Compound Name | (4aS,9aS)-4a-benzylspiro[1,3,4,6,7,8,9,9a-octahydrobenzo[7]annulene-2,2'-1,3-dioxolane]-5-one |
|---|---|
| PubChem CID | 66550155 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (4aS,9aS)-4a-benzylspiro[1,3,4,6,7,8,9,9a-octahydrobenzo[7]annulene-2,2'-1,3-dioxolane]-5-one |
| SMILES | O=C1CCCC[C@H]2CC3(CC[C@@]12Cc1ccccc1)OCCO3 |
| InChI | InChI=1S/C20H26O3/c21-18-9-5-4-8-17-15-20(22-12-13-23-20)11-10-19(17,18)14-16-6-2-1-3-7-16/h1-3,6-7,17H,4-5,8-15H2/t17-,19-/m0/s1 |
| InChIKey | MDBCQIAMIGNNLA-HKUYNNGSSA-N |
| XLogP | 3.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |