About 1-[(1S,3R)-3-(3-fluorophenyl)cyclopentyl]-3-(1-methylindazol-4-yl)urea
1-[(1S,3R)-3-(3-fluorophenyl)cyclopentyl]-3-(1-methylindazol-4-yl)urea (PubChem CID 66550281) has the molecular formula C20H21FN4O
and a molecular weight of 352.41 g/mol. Its IUPAC name is 1-[(1S,3R)-3-(3-fluorophenyl)cyclopentyl]-3-(1-methylindazol-4-yl)urea.
Molecular Properties
| Compound Name | 1-[(1S,3R)-3-(3-fluorophenyl)cyclopentyl]-3-(1-methylindazol-4-yl)urea |
| PubChem CID | 66550281 |
| Molecular Formula | C20H21FN4O |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 1-[(1S,3R)-3-(3-fluorophenyl)cyclopentyl]-3-(1-methylindazol-4-yl)urea |
| SMILES | Cn1ncc2c(NC(=O)N[C@H]3CC[C@@H](c4cccc(F)c4)C3)cccc21 |
| InChI | InChI=1S/C20H21FN4O/c1-25-19-7-3-6-18(17(19)12-22-25)24-20(26)23-16-9-8-14(11-16)13-4-2-5-15(21)10-13/h2-7,10,12,14,16H,8-9,11H2,1H3,(H2,23,24,26)/t14-,16+/m1/s1 |
| InChIKey | VWPBEOFJNRTTPX-ZBFHGGJFSA-N |
| XLogP | 4.17 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(1S,3R)-3-(3-fluorophenyl)cyclopentyl]-3-(1-methylindazol-4-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S,3R)-3-(3-fluorophenyl)cyclopentyl]-3-(1-methylindazol-4-yl)urea?
The IUPAC name of 1-[(1S,3R)-3-(3-fluorophenyl)cyclopentyl]-3-(1-methylindazol-4-yl)urea (CID 66550281) is 1-[(1S,3R)-3-(3-fluorophenyl)cyclopentyl]-3-(1-methylindazol-4-yl)urea.
What is the SMILES notation for 1-[(1S,3R)-3-(3-fluorophenyl)cyclopentyl]-3-(1-methylindazol-4-yl)urea?
The canonical SMILES for 1-[(1S,3R)-3-(3-fluorophenyl)cyclopentyl]-3-(1-methylindazol-4-yl)urea is Cn1ncc2c(NC(=O)N[C@H]3CC[C@@H](c4cccc(F)c4)C3)cccc21.
What is the InChIKey of 1-[(1S,3R)-3-(3-fluorophenyl)cyclopentyl]-3-(1-methylindazol-4-yl)urea?
The InChIKey is VWPBEOFJNRTTPX-ZBFHGGJFSA-N. The full InChI is InChI=1S/C20H21FN4O/c1-25-19-7-3-6-18(17(19)12-22-25)24-20(26)23-16-9-8-14(11-16)13-4-2-5-15(21)10-13/h2-7,10,12,14,16H,8-9,11H2,1H3,(H2,23,24,26)/t14-,16+/m1/s1.
What are the key properties of 1-[(1S,3R)-3-(3-fluorophenyl)cyclopentyl]-3-(1-methylindazol-4-yl)urea?
1-[(1S,3R)-3-(3-fluorophenyl)cyclopentyl]-3-(1-methylindazol-4-yl)urea has a molecular weight of 352.41 g/mol, XLogP of 4.17, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S,3R)-3-(3-fluorophenyl)cyclopentyl]-3-(1-methylindazol-4-yl)urea is sourced from PubChem (CID 66550281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).