C22H17Cl2FN4O2 — CID 66550333
2-amino-N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-5-(2-oxo-1,3-dihydroindol-5-yl)pyridine-3-carboxamide (PubChem CID 66550333) has the molecular formula C22H17Cl2FN4O2 and a molecular weight of 459.31 g/mol. Its IUPAC name is 2-amino-N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-5-(2-oxo-1,3-dihydroindol-5-yl)pyridine-3-carboxamide.
| Compound Name | 2-amino-N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-5-(2-oxo-1,3-dihydroindol-5-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66550333 |
| Molecular Formula | C22H17Cl2FN4O2 |
| Molecular Weight | 459.31 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | 2-amino-N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-5-(2-oxo-1,3-dihydroindol-5-yl)pyridine-3-carboxamide |
| SMILES | CC(NC(=O)c1cc(-c2ccc3c(c2)CC(=O)N3)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C22H17Cl2FN4O2/c1-10(19-15(23)3-4-16(25)20(19)24)28-22(31)14-7-13(9-27-21(14)26)11-2-5-17-12(6-11)8-18(30)29-17/h2-7,9-10H,8H2,1H3,(H2,26,27)(H,28,31)(H,29,30) |
| InChIKey | YXLSVZWTQLJCDU-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.31 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|