About ethyl 4-hydroxy-3,5-bis[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]benzoate
ethyl 4-hydroxy-3,5-bis[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]benzoate (PubChem CID 66550366) has the molecular formula C25H26N2O3+2
and a molecular weight of 402.49 g/mol. Its IUPAC name is ethyl 4-hydroxy-3,5-bis[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]benzoate.
Molecular Properties
| Compound Name | ethyl 4-hydroxy-3,5-bis[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]benzoate |
| PubChem CID | 66550366 |
| Molecular Formula | C25H26N2O3+2 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | ethyl 4-hydroxy-3,5-bis[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]benzoate |
| SMILES | CCOC(=O)c1cc(/C=C/c2cc[n+](C)cc2)c(O)c(/C=C/c2cc[n+](C)cc2)c1 |
| InChI | InChI=1S/C25H25N2O3/c1-4-30-25(29)23-17-21(7-5-19-9-13-26(2)14-10-19)24(28)22(18-23)8-6-20-11-15-27(3)16-12-20/h5-18H,4H2,1-3H3/q+1/p+1 |
| InChIKey | VPLJYFOLQDQWRC-UHFFFAOYSA-O |
| XLogP | 3.56 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-hydroxy-3,5-bis[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-hydroxy-3,5-bis[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]benzoate?
The IUPAC name of ethyl 4-hydroxy-3,5-bis[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]benzoate (CID 66550366) is ethyl 4-hydroxy-3,5-bis[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]benzoate.
What is the SMILES notation for ethyl 4-hydroxy-3,5-bis[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]benzoate?
The canonical SMILES for ethyl 4-hydroxy-3,5-bis[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]benzoate is CCOC(=O)c1cc(/C=C/c2cc[n+](C)cc2)c(O)c(/C=C/c2cc[n+](C)cc2)c1.
What is the InChIKey of ethyl 4-hydroxy-3,5-bis[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]benzoate?
The InChIKey is VPLJYFOLQDQWRC-UHFFFAOYSA-O. The full InChI is InChI=1S/C25H25N2O3/c1-4-30-25(29)23-17-21(7-5-19-9-13-26(2)14-10-19)24(28)22(18-23)8-6-20-11-15-27(3)16-12-20/h5-18H,4H2,1-3H3/q+1/p+1.
What are the key properties of ethyl 4-hydroxy-3,5-bis[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]benzoate?
ethyl 4-hydroxy-3,5-bis[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]benzoate has a molecular weight of 402.49 g/mol, XLogP of 3.56, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-hydroxy-3,5-bis[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]benzoate is sourced from PubChem (CID 66550366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).