C13H23N3O3 — CID 665508
(5S)-5-(2-methylpropyl)-3-(2-morpholin-4-ylethyl)imidazolidine-2,4-dione (PubChem CID 665508) has the molecular formula C13H23N3O3 and a molecular weight of 269.34 g/mol. Its IUPAC name is (5S)-5-(2-methylpropyl)-3-(2-morpholin-4-ylethyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-5-(2-methylpropyl)-3-(2-morpholin-4-ylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 665508 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | (5S)-5-(2-methylpropyl)-3-(2-morpholin-4-ylethyl)imidazolidine-2,4-dione |
| SMILES | CC(C)C[C@@H]1NC(=O)N(CCN2CCOCC2)C1=O |
| InChI | InChI=1S/C13H23N3O3/c1-10(2)9-11-12(17)16(13(18)14-11)4-3-15-5-7-19-8-6-15/h10-11H,3-9H2,1-2H3,(H,14,18)/t11-/m0/s1 |
| InChIKey | CJPZSQXPIGQMKP-NSHDSACASA-N |
| XLogP | 0.29 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|