C22H22FN3O — CID 66551086
1-(6-fluoro-3-methylisoquinolin-5-yl)-3-[(1R,3R)-3-phenylcyclopentyl]urea (PubChem CID 66551086) has the molecular formula C22H22FN3O and a molecular weight of 363.44 g/mol. Its IUPAC name is 1-(6-fluoro-3-methylisoquinolin-5-yl)-3-[(1R,3R)-3-phenylcyclopentyl]urea.
| Compound Name | 1-(6-fluoro-3-methylisoquinolin-5-yl)-3-[(1R,3R)-3-phenylcyclopentyl]urea |
|---|---|
| PubChem CID | 66551086 |
| Molecular Formula | C22H22FN3O |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 1-(6-fluoro-3-methylisoquinolin-5-yl)-3-[(1R,3R)-3-phenylcyclopentyl]urea |
| SMILES | Cc1cc2c(NC(=O)N[C@@H]3CC[C@@H](c4ccccc4)C3)c(F)ccc2cn1 |
| InChI | InChI=1S/C22H22FN3O/c1-14-11-19-17(13-24-14)8-10-20(23)21(19)26-22(27)25-18-9-7-16(12-18)15-5-3-2-4-6-15/h2-6,8,10-11,13,16,18H,7,9,12H2,1H3,(H2,25,26,27)/t16-,18-/m1/s1 |
| InChIKey | BLFYIBROKHRKEJ-SJLPKXTDSA-N |
| XLogP | 5.14 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |