C16H18N4O3S — CID 66551098
tert-butyl N-methyl-N-(4-oxo-2-sulfanylidene-1,9-dihydropyrimido[4,5-b]indol-8-yl)carbamate (PubChem CID 66551098) has the molecular formula C16H18N4O3S and a molecular weight of 346.41 g/mol. Its IUPAC name is tert-butyl N-methyl-N-(4-oxo-2-sulfanylidene-1,9-dihydropyrimido[4,5-b]indol-8-yl)carbamate.
| Compound Name | tert-butyl N-methyl-N-(4-oxo-2-sulfanylidene-1,9-dihydropyrimido[4,5-b]indol-8-yl)carbamate |
|---|---|
| PubChem CID | 66551098 |
| Molecular Formula | C16H18N4O3S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | tert-butyl N-methyl-N-(4-oxo-2-sulfanylidene-1,9-dihydropyrimido[4,5-b]indol-8-yl)carbamate |
| SMILES | CN(C(=O)OC(C)(C)C)c1cccc2c1[nH]c1[nH]c(=S)[nH]c(=O)c12 |
| InChI | InChI=1S/C16H18N4O3S/c1-16(2,3)23-15(22)20(4)9-7-5-6-8-10-12(17-11(8)9)18-14(24)19-13(10)21/h5-7H,1-4H3,(H3,17,18,19,21,24) |
| InChIKey | PNIJJNMQTWRITF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 93.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|