C19H20N4O — CID 66551282
1-(1H-indazol-4-yl)-3-[(1S,3R)-3-phenylcyclopentyl]urea (PubChem CID 66551282) has the molecular formula C19H20N4O and a molecular weight of 320.40 g/mol. Its IUPAC name is 1-(1H-indazol-4-yl)-3-[(1S,3R)-3-phenylcyclopentyl]urea.
| Compound Name | 1-(1H-indazol-4-yl)-3-[(1S,3R)-3-phenylcyclopentyl]urea |
|---|---|
| PubChem CID | 66551282 |
| Molecular Formula | C19H20N4O |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 1-(1H-indazol-4-yl)-3-[(1S,3R)-3-phenylcyclopentyl]urea |
| SMILES | O=C(Nc1cccc2[nH]ncc12)N[C@H]1CC[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C19H20N4O/c24-19(22-17-7-4-8-18-16(17)12-20-23-18)21-15-10-9-14(11-15)13-5-2-1-3-6-13/h1-8,12,14-15H,9-11H2,(H,20,23)(H2,21,22,24)/t14-,15+/m1/s1 |
| InChIKey | JSEHDPNFIUYQLO-CABCVRRESA-N |
| XLogP | 4.02 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |