C11H15F3O3 — CID 66552210
(2S,4S,6R)-2-ethenyl-6-[(Z)-2-(2,2,2-trifluoroethoxy)ethenyl]oxan-4-ol (PubChem CID 66552210) has the molecular formula C11H15F3O3 and a molecular weight of 252.23 g/mol. Its IUPAC name is (2S,4S,6R)-2-ethenyl-6-[(Z)-2-(2,2,2-trifluoroethoxy)ethenyl]oxan-4-ol.
| Compound Name | (2S,4S,6R)-2-ethenyl-6-[(Z)-2-(2,2,2-trifluoroethoxy)ethenyl]oxan-4-ol |
|---|---|
| PubChem CID | 66552210 |
| Molecular Formula | C11H15F3O3 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | (2S,4S,6R)-2-ethenyl-6-[(Z)-2-(2,2,2-trifluoroethoxy)ethenyl]oxan-4-ol |
| SMILES | C=C[C@@H]1C[C@H](O)C[C@H](/C=C\OCC(F)(F)F)O1 |
| InChI | InChI=1S/C11H15F3O3/c1-2-9-5-8(15)6-10(17-9)3-4-16-7-11(12,13)14/h2-4,8-10,15H,1,5-7H2/b4-3-/t8-,9+,10-/m0/s1 |
| InChIKey | XBUJGUHHXLEBDG-VUCKIDGMSA-N |
| XLogP | 2.17 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|