About (2S,3S)-3-aminopentan-2-ol;hydrochloride
(2S,3S)-3-aminopentan-2-ol;hydrochloride (PubChem CID 66552260) has the molecular formula C5H14ClNO
and a molecular weight of 139.63 g/mol. Its IUPAC name is (2S,3S)-3-aminopentan-2-ol;hydrochloride.
Molecular Properties
| Compound Name | (2S,3S)-3-aminopentan-2-ol;hydrochloride |
| PubChem CID | 66552260 |
| Molecular Formula | C5H14ClNO |
| Molecular Weight | 139.63 g/mol |
| Exact Mass | 139.08 |
| IUPAC Name | (2S,3S)-3-aminopentan-2-ol;hydrochloride |
| SMILES | CC[C@H](N)[C@H](C)O.Cl |
| InChI | InChI=1S/C5H13NO.ClH/c1-3-5(6)4(2)7;/h4-5,7H,3,6H2,1-2H3;1H/t4-,5-;/m0./s1 |
| InChIKey | KAJAIXQRKSAXTM-FHAQVOQBSA-N |
| XLogP | 0.53 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.63 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,3S)-3-aminopentan-2-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-3-aminopentan-2-ol;hydrochloride?
The IUPAC name of (2S,3S)-3-aminopentan-2-ol;hydrochloride (CID 66552260) is (2S,3S)-3-aminopentan-2-ol;hydrochloride.
What is the SMILES notation for (2S,3S)-3-aminopentan-2-ol;hydrochloride?
The canonical SMILES for (2S,3S)-3-aminopentan-2-ol;hydrochloride is CC[C@H](N)[C@H](C)O.Cl.
What is the InChIKey of (2S,3S)-3-aminopentan-2-ol;hydrochloride?
The InChIKey is KAJAIXQRKSAXTM-FHAQVOQBSA-N. The full InChI is InChI=1S/C5H13NO.ClH/c1-3-5(6)4(2)7;/h4-5,7H,3,6H2,1-2H3;1H/t4-,5-;/m0./s1.
What are the key properties of (2S,3S)-3-aminopentan-2-ol;hydrochloride?
(2S,3S)-3-aminopentan-2-ol;hydrochloride has a molecular weight of 139.63 g/mol, XLogP of 0.53, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-3-aminopentan-2-ol;hydrochloride is sourced from PubChem (CID 66552260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).