C25H27NO4 — CID 66552307
[(6aR,9R,10aR)-1,9-dihydroxy-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-3-yl]-(1-methylindol-3-yl)methanone (PubChem CID 66552307) has the molecular formula C25H27NO4 and a molecular weight of 405.49 g/mol. Its IUPAC name is [(6aR,9R,10aR)-1,9-dihydroxy-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-3-yl]-(1-methylindol-3-yl)methanone.
| Compound Name | [(6aR,9R,10aR)-1,9-dihydroxy-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-3-yl]-(1-methylindol-3-yl)methanone |
|---|---|
| PubChem CID | 66552307 |
| Molecular Formula | C25H27NO4 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | [(6aR,9R,10aR)-1,9-dihydroxy-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-3-yl]-(1-methylindol-3-yl)methanone |
| SMILES | Cn1cc(C(=O)c2cc(O)c3c(c2)OC(C)(C)[C@@H]2CC[C@@H](O)C[C@@H]32)c2ccccc21 |
| InChI | InChI=1S/C25H27NO4/c1-25(2)19-9-8-15(27)12-17(19)23-21(28)10-14(11-22(23)30-25)24(29)18-13-26(3)20-7-5-4-6-16(18)20/h4-7,10-11,13,15,17,19,27-28H,8-9,12H2,1-3H3/t15-,17-,19-/m1/s1 |
| InChIKey | UGRFMKJROSINFZ-SZVBFZGTSA-N |
| XLogP | 4.53 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |