About (3Z)-3-cyclohexyl-5,5-dimethyl-2-trimethylsilylhexa-1,3-dien-1-one
(3Z)-3-cyclohexyl-5,5-dimethyl-2-trimethylsilylhexa-1,3-dien-1-one (PubChem CID 66552331) has the molecular formula C17H30OSi
and a molecular weight of 278.51 g/mol. Its IUPAC name is (3Z)-3-cyclohexyl-5,5-dimethyl-2-trimethylsilylhexa-1,3-dien-1-one.
Molecular Properties
| Compound Name | (3Z)-3-cyclohexyl-5,5-dimethyl-2-trimethylsilylhexa-1,3-dien-1-one |
| PubChem CID | 66552331 |
| Molecular Formula | C17H30OSi |
| Molecular Weight | 278.51 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | (3Z)-3-cyclohexyl-5,5-dimethyl-2-trimethylsilylhexa-1,3-dien-1-one |
| SMILES | CC(C)(C)/C=C(\C(=C=O)[Si](C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C17H30OSi/c1-17(2,3)12-15(14-10-8-7-9-11-14)16(13-18)19(4,5)6/h12,14H,7-11H2,1-6H3/b15-12- |
| InChIKey | GTMMBRYWBYYCGV-QINSGFPZSA-N |
| XLogP | 5.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.51 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-cyclohexyl-5,5-dimethyl-2-trimethylsilylhexa-1,3-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-cyclohexyl-5,5-dimethyl-2-trimethylsilylhexa-1,3-dien-1-one?
The IUPAC name of (3Z)-3-cyclohexyl-5,5-dimethyl-2-trimethylsilylhexa-1,3-dien-1-one (CID 66552331) is (3Z)-3-cyclohexyl-5,5-dimethyl-2-trimethylsilylhexa-1,3-dien-1-one.
What is the SMILES notation for (3Z)-3-cyclohexyl-5,5-dimethyl-2-trimethylsilylhexa-1,3-dien-1-one?
The canonical SMILES for (3Z)-3-cyclohexyl-5,5-dimethyl-2-trimethylsilylhexa-1,3-dien-1-one is CC(C)(C)/C=C(\C(=C=O)[Si](C)(C)C)C1CCCCC1.
What is the InChIKey of (3Z)-3-cyclohexyl-5,5-dimethyl-2-trimethylsilylhexa-1,3-dien-1-one?
The InChIKey is GTMMBRYWBYYCGV-QINSGFPZSA-N. The full InChI is InChI=1S/C17H30OSi/c1-17(2,3)12-15(14-10-8-7-9-11-14)16(13-18)19(4,5)6/h12,14H,7-11H2,1-6H3/b15-12-.
What are the key properties of (3Z)-3-cyclohexyl-5,5-dimethyl-2-trimethylsilylhexa-1,3-dien-1-one?
(3Z)-3-cyclohexyl-5,5-dimethyl-2-trimethylsilylhexa-1,3-dien-1-one has a molecular weight of 278.51 g/mol, XLogP of 5.17, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-cyclohexyl-5,5-dimethyl-2-trimethylsilylhexa-1,3-dien-1-one is sourced from PubChem (CID 66552331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).