C26H33NO10 — CID 66552684
methyl (2S)-2-[(3S,4R,4aS)-4-ethenyl-8-oxo-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4,4a,5,6-tetrahydro-3H-pyrano[3,4-c]pyridin-7-yl]-3-phenylpropanoate (PubChem CID 66552684) has the molecular formula C26H33NO10 and a molecular weight of 519.55 g/mol. Its IUPAC name is methyl (2S)-2-[(3S,4R,4aS)-4-ethenyl-8-oxo-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4,4a,5,6-tetrahydro-3H-pyrano[3,4-c]pyridin-7-yl]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[(3S,4R,4aS)-4-ethenyl-8-oxo-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4,4a,5,6-tetrahydro-3H-pyrano[3,4-c]pyridin-7-yl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 66552684 |
| Molecular Formula | C26H33NO10 |
| Molecular Weight | 519.55 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | methyl (2S)-2-[(3S,4R,4aS)-4-ethenyl-8-oxo-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4,4a,5,6-tetrahydro-3H-pyrano[3,4-c]pyridin-7-yl]-3-phenylpropanoate |
| SMILES | C=C[C@H]1[C@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)OC=C2C(=O)N([C@@H](Cc3ccccc3)C(=O)OC)CC[C@H]21 |
| InChI | InChI=1S/C26H33NO10/c1-3-15-16-9-10-27(18(24(33)34-2)11-14-7-5-4-6-8-14)23(32)17(16)13-35-25(15)37-26-22(31)21(30)20(29)19(12-28)36-26/h3-8,13,15-16,18-22,25-26,28-31H,1,9-12H2,2H3/t15-,16+,18+,19-,20-,21+,22-,25+,26+/m1/s1 |
| InChIKey | YPGCOIVTFNMDTA-DBXUSRIBSA-N |
| XLogP | -0.52 |
| TPSA | 155.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.55 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|