C19H14F3N3O2 — CID 66552798
6-methyl-N-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]-[1,3]dioxolo[4,5-g]quinolin-8-amine (PubChem CID 66552798) has the molecular formula C19H14F3N3O2 and a molecular weight of 373.33 g/mol. Its IUPAC name is 6-methyl-N-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]-[1,3]dioxolo[4,5-g]quinolin-8-amine.
| Compound Name | 6-methyl-N-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]-[1,3]dioxolo[4,5-g]quinolin-8-amine |
|---|---|
| PubChem CID | 66552798 |
| Molecular Formula | C19H14F3N3O2 |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 6-methyl-N-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]-[1,3]dioxolo[4,5-g]quinolin-8-amine |
| SMILES | Cc1cc(N/N=C/c2ccccc2C(F)(F)F)c2cc3c(cc2n1)OCO3 |
| InChI | InChI=1S/C19H14F3N3O2/c1-11-6-16(13-7-17-18(27-10-26-17)8-15(13)24-11)25-23-9-12-4-2-3-5-14(12)19(20,21)22/h2-9H,10H2,1H3,(H,24,25)/b23-9+ |
| InChIKey | MFUPVANLWGIZAM-NUGSKGIGSA-N |
| XLogP | 4.74 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|