C15H12F2N2S — CID 66552897
5-[(3aS,4R,9bR)-6,8-difluoro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]-1,3-thiazole (PubChem CID 66552897) has the molecular formula C15H12F2N2S and a molecular weight of 290.34 g/mol. Its IUPAC name is 5-[(3aS,4R,9bR)-6,8-difluoro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]-1,3-thiazole.
| Compound Name | 5-[(3aS,4R,9bR)-6,8-difluoro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 66552897 |
| Molecular Formula | C15H12F2N2S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 5-[(3aS,4R,9bR)-6,8-difluoro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]-1,3-thiazole |
| SMILES | Fc1cc(F)c2c(c1)[C@@H]1C=CC[C@@H]1[C@H](c1cncs1)N2 |
| InChI | InChI=1S/C15H12F2N2S/c16-8-4-11-9-2-1-3-10(9)15(13-6-18-7-20-13)19-14(11)12(17)5-8/h1-2,4-7,9-10,15,19H,3H2/t9-,10+,15-/m1/s1 |
| InChIKey | UAMGLTRABHFFKO-HFBDOXOYSA-N |
| XLogP | 4.25 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|