About 1-benzyl-3-(3,5-dimethoxyphenyl)indole
1-benzyl-3-(3,5-dimethoxyphenyl)indole (PubChem CID 66552988) has the molecular formula C23H21NO2
and a molecular weight of 343.43 g/mol. Its IUPAC name is 1-benzyl-3-(3,5-dimethoxyphenyl)indole.
Molecular Properties
| Compound Name | 1-benzyl-3-(3,5-dimethoxyphenyl)indole |
| PubChem CID | 66552988 |
| Molecular Formula | C23H21NO2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 1-benzyl-3-(3,5-dimethoxyphenyl)indole |
| SMILES | COc1cc(OC)cc(-c2cn(Cc3ccccc3)c3ccccc23)c1 |
| InChI | InChI=1S/C23H21NO2/c1-25-19-12-18(13-20(14-19)26-2)22-16-24(15-17-8-4-3-5-9-17)23-11-7-6-10-21(22)23/h3-14,16H,15H2,1-2H3 |
| InChIKey | RNDZFZPMGNWYEB-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-benzyl-3-(3,5-dimethoxyphenyl)indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3-(3,5-dimethoxyphenyl)indole?
The IUPAC name of 1-benzyl-3-(3,5-dimethoxyphenyl)indole (CID 66552988) is 1-benzyl-3-(3,5-dimethoxyphenyl)indole.
What is the SMILES notation for 1-benzyl-3-(3,5-dimethoxyphenyl)indole?
The canonical SMILES for 1-benzyl-3-(3,5-dimethoxyphenyl)indole is COc1cc(OC)cc(-c2cn(Cc3ccccc3)c3ccccc23)c1.
What is the InChIKey of 1-benzyl-3-(3,5-dimethoxyphenyl)indole?
The InChIKey is RNDZFZPMGNWYEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21NO2/c1-25-19-12-18(13-20(14-19)26-2)22-16-24(15-17-8-4-3-5-9-17)23-11-7-6-10-21(22)23/h3-14,16H,15H2,1-2H3.
What are the key properties of 1-benzyl-3-(3,5-dimethoxyphenyl)indole?
1-benzyl-3-(3,5-dimethoxyphenyl)indole has a molecular weight of 343.43 g/mol, XLogP of 5.37, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3-(3,5-dimethoxyphenyl)indole is sourced from PubChem (CID 66552988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).