About (2S,5R)-1-ethyl-2,5-dimethyloxolan-1-ium
(2S,5R)-1-ethyl-2,5-dimethyloxolan-1-ium (PubChem CID 66553021) has the molecular formula C8H17O+
and a molecular weight of 129.22 g/mol. Its IUPAC name is (2S,5R)-1-ethyl-2,5-dimethyloxolan-1-ium.
Molecular Properties
| Compound Name | (2S,5R)-1-ethyl-2,5-dimethyloxolan-1-ium |
| PubChem CID | 66553021 |
| Molecular Formula | C8H17O+ |
| Molecular Weight | 129.22 g/mol |
| Exact Mass | 129.13 |
| IUPAC Name | (2S,5R)-1-ethyl-2,5-dimethyloxolan-1-ium |
| SMILES | CC[O+]1[C@H](C)CC[C@@H]1C |
| InChI | InChI=1S/C8H17O/c1-4-9-7(2)5-6-8(9)3/h7-8H,4-6H2,1-3H3/q+1/t7-,8+ |
| InChIKey | COTRKHILIJCGKW-OCAPTIKFSA-N |
| XLogP | 2.13 |
| TPSA | 2.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze (2S,5R)-1-ethyl-2,5-dimethyloxolan-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5R)-1-ethyl-2,5-dimethyloxolan-1-ium?
The IUPAC name of (2S,5R)-1-ethyl-2,5-dimethyloxolan-1-ium (CID 66553021) is (2S,5R)-1-ethyl-2,5-dimethyloxolan-1-ium.
What is the SMILES notation for (2S,5R)-1-ethyl-2,5-dimethyloxolan-1-ium?
The canonical SMILES for (2S,5R)-1-ethyl-2,5-dimethyloxolan-1-ium is CC[O+]1[C@H](C)CC[C@@H]1C.
What is the InChIKey of (2S,5R)-1-ethyl-2,5-dimethyloxolan-1-ium?
The InChIKey is COTRKHILIJCGKW-OCAPTIKFSA-N. The full InChI is InChI=1S/C8H17O/c1-4-9-7(2)5-6-8(9)3/h7-8H,4-6H2,1-3H3/q+1/t7-,8+.
What are the key properties of (2S,5R)-1-ethyl-2,5-dimethyloxolan-1-ium?
(2S,5R)-1-ethyl-2,5-dimethyloxolan-1-ium has a molecular weight of 129.22 g/mol, XLogP of 2.13, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5R)-1-ethyl-2,5-dimethyloxolan-1-ium is sourced from PubChem (CID 66553021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).