About (4-amino-2-anilino-1,3-thiazol-5-yl)-pyridin-3-ylmethanol
(4-amino-2-anilino-1,3-thiazol-5-yl)-pyridin-3-ylmethanol (PubChem CID 66553049) has the molecular formula C15H14N4OS
and a molecular weight of 298.37 g/mol. Its IUPAC name is (4-amino-2-anilino-1,3-thiazol-5-yl)-pyridin-3-ylmethanol.
Molecular Properties
| Compound Name | (4-amino-2-anilino-1,3-thiazol-5-yl)-pyridin-3-ylmethanol |
| PubChem CID | 66553049 |
| Molecular Formula | C15H14N4OS |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | (4-amino-2-anilino-1,3-thiazol-5-yl)-pyridin-3-ylmethanol |
| SMILES | Nc1nc(Nc2ccccc2)sc1C(O)c1cccnc1 |
| InChI | InChI=1S/C15H14N4OS/c16-14-13(12(20)10-5-4-8-17-9-10)21-15(19-14)18-11-6-2-1-3-7-11/h1-9,12,20H,16H2,(H,18,19) |
| InChIKey | WVJNLMMIPZIZRR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (4-amino-2-anilino-1,3-thiazol-5-yl)-pyridin-3-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-2-anilino-1,3-thiazol-5-yl)-pyridin-3-ylmethanol?
The IUPAC name of (4-amino-2-anilino-1,3-thiazol-5-yl)-pyridin-3-ylmethanol (CID 66553049) is (4-amino-2-anilino-1,3-thiazol-5-yl)-pyridin-3-ylmethanol.
What is the SMILES notation for (4-amino-2-anilino-1,3-thiazol-5-yl)-pyridin-3-ylmethanol?
The canonical SMILES for (4-amino-2-anilino-1,3-thiazol-5-yl)-pyridin-3-ylmethanol is Nc1nc(Nc2ccccc2)sc1C(O)c1cccnc1.
What is the InChIKey of (4-amino-2-anilino-1,3-thiazol-5-yl)-pyridin-3-ylmethanol?
The InChIKey is WVJNLMMIPZIZRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N4OS/c16-14-13(12(20)10-5-4-8-17-9-10)21-15(19-14)18-11-6-2-1-3-7-11/h1-9,12,20H,16H2,(H,18,19).
What are the key properties of (4-amino-2-anilino-1,3-thiazol-5-yl)-pyridin-3-ylmethanol?
(4-amino-2-anilino-1,3-thiazol-5-yl)-pyridin-3-ylmethanol has a molecular weight of 298.37 g/mol, XLogP of 2.95, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-2-anilino-1,3-thiazol-5-yl)-pyridin-3-ylmethanol is sourced from PubChem (CID 66553049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).