C10H18N5O6P — CID 66553118
[(2R,3S,5R)-5-(6-amino-1,4,7,8-tetrahydropurin-9-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 66553118) has the molecular formula C10H18N5O6P and a molecular weight of 335.26 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-amino-1,4,7,8-tetrahydropurin-9-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,5R)-5-(6-amino-1,4,7,8-tetrahydropurin-9-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 66553118 |
| Molecular Formula | C10H18N5O6P |
| Molecular Weight | 335.26 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | [(2R,3S,5R)-5-(6-amino-1,4,7,8-tetrahydropurin-9-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | NC1=C2NCN([C@H]3C[C@H](O)[C@@H](COP(=O)(O)O)O3)C2N=CN1 |
| InChI | InChI=1S/C10H18N5O6P/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(16)6(21-7)2-20-22(17,18)19/h3,5-7,10,14,16H,1-2,4,11H2,(H,12,13)(H2,17,18,19)/t5-,6+,7+,10?/m0/s1 |
| InChIKey | TXFZPENBFGUFFW-PLDAJOQYSA-N |
| XLogP | -2.48 |
| TPSA | 161.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.26 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|