C21H16FNO2 — CID 66553454
5-(2,6-dimethylphenyl)-9-fluoro-3-hydroxyphenanthridin-6-one (PubChem CID 66553454) has the molecular formula C21H16FNO2 and a molecular weight of 333.36 g/mol. Its IUPAC name is 5-(2,6-dimethylphenyl)-9-fluoro-3-hydroxyphenanthridin-6-one.
| Compound Name | 5-(2,6-dimethylphenyl)-9-fluoro-3-hydroxyphenanthridin-6-one |
|---|---|
| PubChem CID | 66553454 |
| Molecular Formula | C21H16FNO2 |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 5-(2,6-dimethylphenyl)-9-fluoro-3-hydroxyphenanthridin-6-one |
| SMILES | Cc1cccc(C)c1-n1c(=O)c2ccc(F)cc2c2ccc(O)cc21 |
| InChI | InChI=1S/C21H16FNO2/c1-12-4-3-5-13(2)20(12)23-19-11-15(24)7-9-16(19)18-10-14(22)6-8-17(18)21(23)25/h3-11,24H,1-2H3 |
| InChIKey | SHEBRNZAYJGXRY-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|