About 6-(dimethylamino)-2-(10-hydroxydecyl)-4,5-dimethylpyridin-3-ol
6-(dimethylamino)-2-(10-hydroxydecyl)-4,5-dimethylpyridin-3-ol (PubChem CID 66553750) has the molecular formula C19H34N2O2
and a molecular weight of 322.49 g/mol. Its IUPAC name is 6-(dimethylamino)-2-(10-hydroxydecyl)-4,5-dimethylpyridin-3-ol.
Molecular Properties
| Compound Name | 6-(dimethylamino)-2-(10-hydroxydecyl)-4,5-dimethylpyridin-3-ol |
| PubChem CID | 66553750 |
| Molecular Formula | C19H34N2O2 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.26 |
| IUPAC Name | 6-(dimethylamino)-2-(10-hydroxydecyl)-4,5-dimethylpyridin-3-ol |
| SMILES | Cc1c(N(C)C)nc(CCCCCCCCCCO)c(O)c1C |
| InChI | InChI=1S/C19H34N2O2/c1-15-16(2)19(21(3)4)20-17(18(15)23)13-11-9-7-5-6-8-10-12-14-22/h22-23H,5-14H2,1-4H3 |
| InChIKey | WRLFELULGGLSGX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 56.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(dimethylamino)-2-(10-hydroxydecyl)-4,5-dimethylpyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(dimethylamino)-2-(10-hydroxydecyl)-4,5-dimethylpyridin-3-ol?
The IUPAC name of 6-(dimethylamino)-2-(10-hydroxydecyl)-4,5-dimethylpyridin-3-ol (CID 66553750) is 6-(dimethylamino)-2-(10-hydroxydecyl)-4,5-dimethylpyridin-3-ol.
What is the SMILES notation for 6-(dimethylamino)-2-(10-hydroxydecyl)-4,5-dimethylpyridin-3-ol?
The canonical SMILES for 6-(dimethylamino)-2-(10-hydroxydecyl)-4,5-dimethylpyridin-3-ol is Cc1c(N(C)C)nc(CCCCCCCCCCO)c(O)c1C.
What is the InChIKey of 6-(dimethylamino)-2-(10-hydroxydecyl)-4,5-dimethylpyridin-3-ol?
The InChIKey is WRLFELULGGLSGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H34N2O2/c1-15-16(2)19(21(3)4)20-17(18(15)23)13-11-9-7-5-6-8-10-12-14-22/h22-23H,5-14H2,1-4H3.
What are the key properties of 6-(dimethylamino)-2-(10-hydroxydecyl)-4,5-dimethylpyridin-3-ol?
6-(dimethylamino)-2-(10-hydroxydecyl)-4,5-dimethylpyridin-3-ol has a molecular weight of 322.49 g/mol, XLogP of 4.13, 11 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(dimethylamino)-2-(10-hydroxydecyl)-4,5-dimethylpyridin-3-ol is sourced from PubChem (CID 66553750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).