C14H24N2O2 — CID 66554244
[(4aR,6S,8aS)-8a-hydroxy-6-(methylamino)-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]-cyclopropylmethanone (PubChem CID 66554244) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is [(4aR,6S,8aS)-8a-hydroxy-6-(methylamino)-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]-cyclopropylmethanone.
| Compound Name | [(4aR,6S,8aS)-8a-hydroxy-6-(methylamino)-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 66554244 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | [(4aR,6S,8aS)-8a-hydroxy-6-(methylamino)-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]-cyclopropylmethanone |
| SMILES | CN[C@H]1CC[C@@]2(O)CN(C(=O)C3CC3)CC[C@@H]2C1 |
| InChI | InChI=1S/C14H24N2O2/c1-15-12-4-6-14(18)9-16(7-5-11(14)8-12)13(17)10-2-3-10/h10-12,15,18H,2-9H2,1H3/t11-,12+,14-/m1/s1 |
| InChIKey | AIKGKOCMQGULSP-MBNYWOFBSA-N |
| XLogP | 0.75 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |