C21H33N3O6SSi — CID 66554312
[(2S,3S,4aR,5R,7R,8S,8aS)-5-(azidomethyl)-2,3-dimethoxy-2,3-dimethyl-7-phenylsulfanyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-yl]oxy-trimethylsilane (PubChem CID 66554312) has the molecular formula C21H33N3O6SSi and a molecular weight of 483.66 g/mol. Its IUPAC name is [(2S,3S,4aR,5R,7R,8S,8aS)-5-(azidomethyl)-2,3-dimethoxy-2,3-dimethyl-7-phenylsulfanyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-yl]oxy-trimethylsilane.
| Compound Name | [(2S,3S,4aR,5R,7R,8S,8aS)-5-(azidomethyl)-2,3-dimethoxy-2,3-dimethyl-7-phenylsulfanyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 66554312 |
| Molecular Formula | C21H33N3O6SSi |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | [(2S,3S,4aR,5R,7R,8S,8aS)-5-(azidomethyl)-2,3-dimethoxy-2,3-dimethyl-7-phenylsulfanyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-yl]oxy-trimethylsilane |
| SMILES | CO[C@@]1(C)O[C@@H]2[C@H](O[Si](C)(C)C)[C@@H](Sc3ccccc3)O[C@H](CN=[N+]=[N-])[C@H]2O[C@]1(C)OC |
| InChI | InChI=1S/C21H33N3O6SSi/c1-20(25-3)21(2,26-4)29-17-16(28-20)15(13-23-24-22)27-19(18(17)30-32(5,6)7)31-14-11-9-8-10-12-14/h8-12,15-19H,13H2,1-7H3/t15-,16-,17+,18+,19-,20+,21+/m1/s1 |
| InChIKey | ZGHHRQNAZPYJFX-XITMGRHOSA-N |
| XLogP | 4.54 |
| TPSA | 104.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|