About 8-methoxy-N,N,5-trimethylpyrimido[5,4-b]indol-4-amine
8-methoxy-N,N,5-trimethylpyrimido[5,4-b]indol-4-amine (PubChem CID 665544) has the molecular formula C14H16N4O
and a molecular weight of 256.31 g/mol. Its IUPAC name is 8-methoxy-N,N,5-trimethylpyrimido[5,4-b]indol-4-amine.
Molecular Properties
| Compound Name | 8-methoxy-N,N,5-trimethylpyrimido[5,4-b]indol-4-amine |
| PubChem CID | 665544 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 8-methoxy-N,N,5-trimethylpyrimido[5,4-b]indol-4-amine |
| SMILES | COc1ccc2c(c1)c1ncnc(N(C)C)c1n2C |
| InChI | InChI=1S/C14H16N4O/c1-17(2)14-13-12(15-8-16-14)10-7-9(19-4)5-6-11(10)18(13)3/h5-8H,1-4H3 |
| InChIKey | LZIHHOWOYPDLSX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-methoxy-N,N,5-trimethylpyrimido[5,4-b]indol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-N,N,5-trimethylpyrimido[5,4-b]indol-4-amine?
The IUPAC name of 8-methoxy-N,N,5-trimethylpyrimido[5,4-b]indol-4-amine (CID 665544) is 8-methoxy-N,N,5-trimethylpyrimido[5,4-b]indol-4-amine.
What is the SMILES notation for 8-methoxy-N,N,5-trimethylpyrimido[5,4-b]indol-4-amine?
The canonical SMILES for 8-methoxy-N,N,5-trimethylpyrimido[5,4-b]indol-4-amine is COc1ccc2c(c1)c1ncnc(N(C)C)c1n2C.
What is the InChIKey of 8-methoxy-N,N,5-trimethylpyrimido[5,4-b]indol-4-amine?
The InChIKey is LZIHHOWOYPDLSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4O/c1-17(2)14-13-12(15-8-16-14)10-7-9(19-4)5-6-11(10)18(13)3/h5-8H,1-4H3.
What are the key properties of 8-methoxy-N,N,5-trimethylpyrimido[5,4-b]indol-4-amine?
8-methoxy-N,N,5-trimethylpyrimido[5,4-b]indol-4-amine has a molecular weight of 256.31 g/mol, XLogP of 2.20, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-N,N,5-trimethylpyrimido[5,4-b]indol-4-amine is sourced from PubChem (CID 665544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).