About 5-[3-(6-cyclopropylpyrazin-2-yl)-1H-indol-5-yl]-1,3,4-oxadiazol-2-amine
5-[3-(6-cyclopropylpyrazin-2-yl)-1H-indol-5-yl]-1,3,4-oxadiazol-2-amine (PubChem CID 66554901) has the molecular formula C17H14N6O
and a molecular weight of 318.34 g/mol. Its IUPAC name is 5-[3-(6-cyclopropylpyrazin-2-yl)-1H-indol-5-yl]-1,3,4-oxadiazol-2-amine.
Molecular Properties
| Compound Name | 5-[3-(6-cyclopropylpyrazin-2-yl)-1H-indol-5-yl]-1,3,4-oxadiazol-2-amine |
| PubChem CID | 66554901 |
| Molecular Formula | C17H14N6O |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 5-[3-(6-cyclopropylpyrazin-2-yl)-1H-indol-5-yl]-1,3,4-oxadiazol-2-amine |
| SMILES | Nc1nnc(-c2ccc3[nH]cc(-c4cncc(C5CC5)n4)c3c2)o1 |
| InChI | InChI=1S/C17H14N6O/c18-17-23-22-16(24-17)10-3-4-13-11(5-10)12(6-20-13)15-8-19-7-14(21-15)9-1-2-9/h3-9,20H,1-2H2,(H2,18,23) |
| InChIKey | JBUOFUIXSMJURC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[3-(6-cyclopropylpyrazin-2-yl)-1H-indol-5-yl]-1,3,4-oxadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(6-cyclopropylpyrazin-2-yl)-1H-indol-5-yl]-1,3,4-oxadiazol-2-amine?
The IUPAC name of 5-[3-(6-cyclopropylpyrazin-2-yl)-1H-indol-5-yl]-1,3,4-oxadiazol-2-amine (CID 66554901) is 5-[3-(6-cyclopropylpyrazin-2-yl)-1H-indol-5-yl]-1,3,4-oxadiazol-2-amine.
What is the SMILES notation for 5-[3-(6-cyclopropylpyrazin-2-yl)-1H-indol-5-yl]-1,3,4-oxadiazol-2-amine?
The canonical SMILES for 5-[3-(6-cyclopropylpyrazin-2-yl)-1H-indol-5-yl]-1,3,4-oxadiazol-2-amine is Nc1nnc(-c2ccc3[nH]cc(-c4cncc(C5CC5)n4)c3c2)o1.
What is the InChIKey of 5-[3-(6-cyclopropylpyrazin-2-yl)-1H-indol-5-yl]-1,3,4-oxadiazol-2-amine?
The InChIKey is JBUOFUIXSMJURC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N6O/c18-17-23-22-16(24-17)10-3-4-13-11(5-10)12(6-20-13)15-8-19-7-14(21-15)9-1-2-9/h3-9,20H,1-2H2,(H2,18,23).
What are the key properties of 5-[3-(6-cyclopropylpyrazin-2-yl)-1H-indol-5-yl]-1,3,4-oxadiazol-2-amine?
5-[3-(6-cyclopropylpyrazin-2-yl)-1H-indol-5-yl]-1,3,4-oxadiazol-2-amine has a molecular weight of 318.34 g/mol, XLogP of 3.13, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(6-cyclopropylpyrazin-2-yl)-1H-indol-5-yl]-1,3,4-oxadiazol-2-amine is sourced from PubChem (CID 66554901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).