C11H12Cl2O2 — CID 66555128
5,7-dichloro-2,2-dimethyl-3,4-dihydrochromen-6-ol (PubChem CID 66555128) has the molecular formula C11H12Cl2O2 and a molecular weight of 247.12 g/mol. Its IUPAC name is 5,7-dichloro-2,2-dimethyl-3,4-dihydrochromen-6-ol.
| Compound Name | 5,7-dichloro-2,2-dimethyl-3,4-dihydrochromen-6-ol |
|---|---|
| PubChem CID | 66555128 |
| Molecular Formula | C11H12Cl2O2 |
| Molecular Weight | 247.12 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | 5,7-dichloro-2,2-dimethyl-3,4-dihydrochromen-6-ol |
| SMILES | CC1(C)CCc2c(cc(Cl)c(O)c2Cl)O1 |
| InChI | InChI=1S/C11H12Cl2O2/c1-11(2)4-3-6-8(15-11)5-7(12)10(14)9(6)13/h5,14H,3-4H2,1-2H3 |
| InChIKey | OHYZLFJDYAGFJE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.12 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |