About N-[(3-fluoropiperidin-3-yl)methyl]-7-(5-methoxy-3-pyridinyl)pyrido[3,4-b]pyrazin-5-amine
N-[(3-fluoropiperidin-3-yl)methyl]-7-(5-methoxy-3-pyridinyl)pyrido[3,4-b]pyrazin-5-amine (PubChem CID 66555180) has the molecular formula C19H21FN6O
and a molecular weight of 368.42 g/mol. Its IUPAC name is N-[(3-fluoropiperidin-3-yl)methyl]-7-(5-methoxy-3-pyridinyl)pyrido[3,4-b]pyrazin-5-amine.
Molecular Properties
| Compound Name | N-[(3-fluoropiperidin-3-yl)methyl]-7-(5-methoxy-3-pyridinyl)pyrido[3,4-b]pyrazin-5-amine |
| PubChem CID | 66555180 |
| Molecular Formula | C19H21FN6O |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | N-[(3-fluoropiperidin-3-yl)methyl]-7-(5-methoxy-3-pyridinyl)pyrido[3,4-b]pyrazin-5-amine |
| SMILES | COc1cncc(-c2cc3nccnc3c(NCC3(F)CCCNC3)n2)c1 |
| InChI | InChI=1S/C19H21FN6O/c1-27-14-7-13(9-22-10-14)15-8-16-17(24-6-5-23-16)18(26-15)25-12-19(20)3-2-4-21-11-19/h5-10,21H,2-4,11-12H2,1H3,(H,25,26) |
| InChIKey | JNKRDQMDLHGUIH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 84.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[(3-fluoropiperidin-3-yl)methyl]-7-(5-methoxy-3-pyridinyl)pyrido[3,4-b]pyrazin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-fluoropiperidin-3-yl)methyl]-7-(5-methoxy-3-pyridinyl)pyrido[3,4-b]pyrazin-5-amine?
The IUPAC name of N-[(3-fluoropiperidin-3-yl)methyl]-7-(5-methoxy-3-pyridinyl)pyrido[3,4-b]pyrazin-5-amine (CID 66555180) is N-[(3-fluoropiperidin-3-yl)methyl]-7-(5-methoxy-3-pyridinyl)pyrido[3,4-b]pyrazin-5-amine.
What is the SMILES notation for N-[(3-fluoropiperidin-3-yl)methyl]-7-(5-methoxy-3-pyridinyl)pyrido[3,4-b]pyrazin-5-amine?
The canonical SMILES for N-[(3-fluoropiperidin-3-yl)methyl]-7-(5-methoxy-3-pyridinyl)pyrido[3,4-b]pyrazin-5-amine is COc1cncc(-c2cc3nccnc3c(NCC3(F)CCCNC3)n2)c1.
What is the InChIKey of N-[(3-fluoropiperidin-3-yl)methyl]-7-(5-methoxy-3-pyridinyl)pyrido[3,4-b]pyrazin-5-amine?
The InChIKey is JNKRDQMDLHGUIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21FN6O/c1-27-14-7-13(9-22-10-14)15-8-16-17(24-6-5-23-16)18(26-15)25-12-19(20)3-2-4-21-11-19/h5-10,21H,2-4,11-12H2,1H3,(H,25,26).
What are the key properties of N-[(3-fluoropiperidin-3-yl)methyl]-7-(5-methoxy-3-pyridinyl)pyrido[3,4-b]pyrazin-5-amine?
N-[(3-fluoropiperidin-3-yl)methyl]-7-(5-methoxy-3-pyridinyl)pyrido[3,4-b]pyrazin-5-amine has a molecular weight of 368.42 g/mol, XLogP of 2.60, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-fluoropiperidin-3-yl)methyl]-7-(5-methoxy-3-pyridinyl)pyrido[3,4-b]pyrazin-5-amine is sourced from PubChem (CID 66555180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).