C23H22O8S — CID 66555721
[6-(benzenesulfonyloxy)-3-hydroxy-8-methyl-9,10-dioxatetracyclo[4.3.1.02,5.03,8]decan-2-yl]methyl benzoate (PubChem CID 66555721) has the molecular formula C23H22O8S and a molecular weight of 458.49 g/mol. Its IUPAC name is [6-(benzenesulfonyloxy)-3-hydroxy-8-methyl-9,10-dioxatetracyclo[4.3.1.02,5.03,8]decan-2-yl]methyl benzoate.
| Compound Name | [6-(benzenesulfonyloxy)-3-hydroxy-8-methyl-9,10-dioxatetracyclo[4.3.1.02,5.03,8]decan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 66555721 |
| Molecular Formula | C23H22O8S |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | [6-(benzenesulfonyloxy)-3-hydroxy-8-methyl-9,10-dioxatetracyclo[4.3.1.02,5.03,8]decan-2-yl]methyl benzoate |
| SMILES | CC12CC3(OS(=O)(=O)c4ccccc4)OC(O1)C1(COC(=O)c4ccccc4)C3CC21O |
| InChI | InChI=1S/C23H22O8S/c1-20-13-22(31-32(26,27)16-10-6-3-7-11-16)17-12-23(20,25)21(17,19(29-20)30-22)14-28-18(24)15-8-4-2-5-9-15/h2-11,17,19,25H,12-14H2,1H3 |
| InChIKey | UQJJXQYELNMMJQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|