About 7-(1-methylpyrazol-4-yl)-5-[[(3S)-piperidin-3-yl]methoxy]pyrido[3,4-b]pyrazine
7-(1-methylpyrazol-4-yl)-5-[[(3S)-piperidin-3-yl]methoxy]pyrido[3,4-b]pyrazine (PubChem CID 66556033) has the molecular formula C17H20N6O
and a molecular weight of 324.39 g/mol. Its IUPAC name is 7-(1-methylpyrazol-4-yl)-5-[[(3S)-piperidin-3-yl]methoxy]pyrido[3,4-b]pyrazine.
Molecular Properties
| Compound Name | 7-(1-methylpyrazol-4-yl)-5-[[(3S)-piperidin-3-yl]methoxy]pyrido[3,4-b]pyrazine |
| PubChem CID | 66556033 |
| Molecular Formula | C17H20N6O |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 7-(1-methylpyrazol-4-yl)-5-[[(3S)-piperidin-3-yl]methoxy]pyrido[3,4-b]pyrazine |
| SMILES | Cn1cc(-c2cc3nccnc3c(OC[C@H]3CCCNC3)n2)cn1 |
| InChI | InChI=1S/C17H20N6O/c1-23-10-13(9-21-23)14-7-15-16(20-6-5-19-15)17(22-14)24-11-12-3-2-4-18-8-12/h5-7,9-10,12,18H,2-4,8,11H2,1H3/t12-/m0/s1 |
| InChIKey | NYXQIXYXIOVJPB-LBPRGKRZSA-N |
| XLogP | 1.80 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 7-(1-methylpyrazol-4-yl)-5-[[(3S)-piperidin-3-yl]methoxy]pyrido[3,4-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(1-methylpyrazol-4-yl)-5-[[(3S)-piperidin-3-yl]methoxy]pyrido[3,4-b]pyrazine?
The IUPAC name of 7-(1-methylpyrazol-4-yl)-5-[[(3S)-piperidin-3-yl]methoxy]pyrido[3,4-b]pyrazine (CID 66556033) is 7-(1-methylpyrazol-4-yl)-5-[[(3S)-piperidin-3-yl]methoxy]pyrido[3,4-b]pyrazine.
What is the SMILES notation for 7-(1-methylpyrazol-4-yl)-5-[[(3S)-piperidin-3-yl]methoxy]pyrido[3,4-b]pyrazine?
The canonical SMILES for 7-(1-methylpyrazol-4-yl)-5-[[(3S)-piperidin-3-yl]methoxy]pyrido[3,4-b]pyrazine is Cn1cc(-c2cc3nccnc3c(OC[C@H]3CCCNC3)n2)cn1.
What is the InChIKey of 7-(1-methylpyrazol-4-yl)-5-[[(3S)-piperidin-3-yl]methoxy]pyrido[3,4-b]pyrazine?
The InChIKey is NYXQIXYXIOVJPB-LBPRGKRZSA-N. The full InChI is InChI=1S/C17H20N6O/c1-23-10-13(9-21-23)14-7-15-16(20-6-5-19-15)17(22-14)24-11-12-3-2-4-18-8-12/h5-7,9-10,12,18H,2-4,8,11H2,1H3/t12-/m0/s1.
What are the key properties of 7-(1-methylpyrazol-4-yl)-5-[[(3S)-piperidin-3-yl]methoxy]pyrido[3,4-b]pyrazine?
7-(1-methylpyrazol-4-yl)-5-[[(3S)-piperidin-3-yl]methoxy]pyrido[3,4-b]pyrazine has a molecular weight of 324.39 g/mol, XLogP of 1.80, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(1-methylpyrazol-4-yl)-5-[[(3S)-piperidin-3-yl]methoxy]pyrido[3,4-b]pyrazine is sourced from PubChem (CID 66556033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).