C8H16Cl4N3O2P3 — CID 66557009
2,2,4,4-tetrachloro-9,9,10,10-tetramethyl-7,12-dioxa-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphaspiro[5.6]dodeca-1(6),2,4-triene (PubChem CID 66557009) has the molecular formula C8H16Cl4N3O2P3 and a molecular weight of 420.97 g/mol. Its IUPAC name is 2,2,4,4-tetrachloro-9,9,10,10-tetramethyl-7,12-dioxa-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphaspiro[5.6]dodeca-1(6),2,4-triene.
| Compound Name | 2,2,4,4-tetrachloro-9,9,10,10-tetramethyl-7,12-dioxa-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphaspiro[5.6]dodeca-1(6),2,4-triene |
|---|---|
| PubChem CID | 66557009 |
| Molecular Formula | C8H16Cl4N3O2P3 |
| Molecular Weight | 420.97 g/mol |
| Exact Mass | 418.92 |
| IUPAC Name | 2,2,4,4-tetrachloro-9,9,10,10-tetramethyl-7,12-dioxa-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphaspiro[5.6]dodeca-1(6),2,4-triene |
| SMILES | CC1(C)COP2(=NP(Cl)(Cl)=NP(Cl)(Cl)=N2)OCC1(C)C |
| InChI | InChI=1S/C8H16Cl4N3O2P3/c1-7(2)5-16-20(17-6-8(7,3)4)14-18(9,10)13-19(11,12)15-20/h5-6H2,1-4H3 |
| InChIKey | ZVIHENWJWUGJTL-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 55.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.97 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|