C14H18O2 — CID 66557206
(4aR,11aS)-4a-methyl-2,3,4,5,6,7-hexahydrobenzo[i]chromen-9-one (PubChem CID 66557206) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is (4aR,11aS)-4a-methyl-2,3,4,5,6,7-hexahydrobenzo[i]chromen-9-one.
| Compound Name | (4aR,11aS)-4a-methyl-2,3,4,5,6,7-hexahydrobenzo[i]chromen-9-one |
|---|---|
| PubChem CID | 66557206 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (4aR,11aS)-4a-methyl-2,3,4,5,6,7-hexahydrobenzo[i]chromen-9-one |
| SMILES | C[C@@]12CCCO[C@@]13C=CC(=O)C=C3CCC2 |
| InChI | InChI=1S/C14H18O2/c1-13-6-2-4-11-10-12(15)5-8-14(11,13)16-9-3-7-13/h5,8,10H,2-4,6-7,9H2,1H3/t13-,14-/m1/s1 |
| InChIKey | ZSHYNPBQBFOCAY-ZIAGYGMSSA-N |
| XLogP | 2.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |