C16H22O3 — CID 66557280
(4aS,11aS)-4a-(3-hydroxypropyl)-2,3,4,5,6,7-hexahydrobenzo[i]chromen-9-one (PubChem CID 66557280) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is (4aS,11aS)-4a-(3-hydroxypropyl)-2,3,4,5,6,7-hexahydrobenzo[i]chromen-9-one.
| Compound Name | (4aS,11aS)-4a-(3-hydroxypropyl)-2,3,4,5,6,7-hexahydrobenzo[i]chromen-9-one |
|---|---|
| PubChem CID | 66557280 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | (4aS,11aS)-4a-(3-hydroxypropyl)-2,3,4,5,6,7-hexahydrobenzo[i]chromen-9-one |
| SMILES | O=C1C=C[C@]23OCCC[C@@]2(CCCO)CCCC3=C1 |
| InChI | InChI=1S/C16H22O3/c17-10-2-7-15-6-1-4-13-12-14(18)5-9-16(13,15)19-11-3-8-15/h5,9,12,17H,1-4,6-8,10-11H2/t15-,16+/m0/s1 |
| InChIKey | QGJCCPPUYLMRLI-JKSUJKDBSA-N |
| XLogP | 2.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |