C15H16Cl2N2O5S — CID 66558016
4-[5-(2,3-dichlorophenyl)-1,2-oxazol-3-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide (PubChem CID 66558016) has the molecular formula C15H16Cl2N2O5S and a molecular weight of 407.28 g/mol. Its IUPAC name is 4-[5-(2,3-dichlorophenyl)-1,2-oxazol-3-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | 4-[5-(2,3-dichlorophenyl)-1,2-oxazol-3-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 66558016 |
| Molecular Formula | C15H16Cl2N2O5S |
| Molecular Weight | 407.28 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | 4-[5-(2,3-dichlorophenyl)-1,2-oxazol-3-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
| SMILES | CC(CCc1cc(-c2cccc(Cl)c2Cl)on1)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C15H16Cl2N2O5S/c1-15(14(20)18-21,25(2,22)23)7-6-9-8-12(24-19-9)10-4-3-5-11(16)13(10)17/h3-5,8,21H,6-7H2,1-2H3,(H,18,20) |
| InChIKey | CVXUCGSXHDPRDD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|