C16H21N3O4S — CID 66558303
N-hydroxy-2-methyl-4-[4-(4-methylphenyl)pyrazol-1-yl]-2-methylsulfonylbutanamide (PubChem CID 66558303) has the molecular formula C16H21N3O4S and a molecular weight of 351.43 g/mol. Its IUPAC name is N-hydroxy-2-methyl-4-[4-(4-methylphenyl)pyrazol-1-yl]-2-methylsulfonylbutanamide.
| Compound Name | N-hydroxy-2-methyl-4-[4-(4-methylphenyl)pyrazol-1-yl]-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 66558303 |
| Molecular Formula | C16H21N3O4S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N-hydroxy-2-methyl-4-[4-(4-methylphenyl)pyrazol-1-yl]-2-methylsulfonylbutanamide |
| SMILES | Cc1ccc(-c2cnn(CCC(C)(C(=O)NO)S(C)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C16H21N3O4S/c1-12-4-6-13(7-5-12)14-10-17-19(11-14)9-8-16(2,15(20)18-21)24(3,22)23/h4-7,10-11,21H,8-9H2,1-3H3,(H,18,20) |
| InChIKey | LEIRWBCURNVGMT-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|