C26H27N5O3 — CID 66558366
1-[3-(3,4-dimethoxyphenyl)pyrido[2,3-b]pyrazin-6-yl]-3-(4-phenylbutyl)urea (PubChem CID 66558366) has the molecular formula C26H27N5O3 and a molecular weight of 457.53 g/mol. Its IUPAC name is 1-[3-(3,4-dimethoxyphenyl)pyrido[2,3-b]pyrazin-6-yl]-3-(4-phenylbutyl)urea.
| Compound Name | 1-[3-(3,4-dimethoxyphenyl)pyrido[2,3-b]pyrazin-6-yl]-3-(4-phenylbutyl)urea |
|---|---|
| PubChem CID | 66558366 |
| Molecular Formula | C26H27N5O3 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 1-[3-(3,4-dimethoxyphenyl)pyrido[2,3-b]pyrazin-6-yl]-3-(4-phenylbutyl)urea |
| SMILES | COc1ccc(-c2cnc3ccc(NC(=O)NCCCCc4ccccc4)nc3n2)cc1OC |
| InChI | InChI=1S/C26H27N5O3/c1-33-22-13-11-19(16-23(22)34-2)21-17-28-20-12-14-24(30-25(20)29-21)31-26(32)27-15-7-6-10-18-8-4-3-5-9-18/h3-5,8-9,11-14,16-17H,6-7,10,15H2,1-2H3,(H2,27,29,30,31,32) |
| InChIKey | VLTWGPTYUIJLBH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|